C22H30O3 — CID 88617026
(8R,9S,10R,13S,14S,17R)-17-ethynyl-13-methylspiro[1,2,4,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,3'-dioxolane]-17-ol (PubChem CID 88617026) has the molecular formula C22H30O3 and a molecular weight of 342.48 g/mol. Its IUPAC name is (8R,9S,10R,13S,14S,17R)-17-ethynyl-13-methylspiro[1,2,4,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,3'-dioxolane]-17-ol.
| Compound Name | (8R,9S,10R,13S,14S,17R)-17-ethynyl-13-methylspiro[1,2,4,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,3'-dioxolane]-17-ol |
|---|---|
| PubChem CID | 88617026 |
| Molecular Formula | C22H30O3 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | (8R,9S,10R,13S,14S,17R)-17-ethynyl-13-methylspiro[1,2,4,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,3'-dioxolane]-17-ol |
| SMILES | C#C[C@]1(O)CC[C@H]2[C@@H]3CC=C4CC5(CCOO5)CC[C@@H]4[C@H]3CC[C@@]21C |
| InChI | InChI=1S/C22H30O3/c1-3-22(23)11-8-19-18-5-4-15-14-21(12-13-24-25-21)10-7-16(15)17(18)6-9-20(19,22)2/h1,4,16-19,23H,5-14H2,2H3/t16-,17+,18+,19-,20-,21?,22-/m0/s1 |
| InChIKey | YTLRCHMROVSVNU-RZUJWMQMSA-N |
| XLogP | 4.01 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|