C11H12N2O3S — CID 88618415
4-methyl-2-(4H-pyrimidin-3-yl)benzenesulfonic acid (PubChem CID 88618415) has the molecular formula C11H12N2O3S and a molecular weight of 252.30 g/mol. Its IUPAC name is 4-methyl-2-(4H-pyrimidin-3-yl)benzenesulfonic acid.
| Compound Name | 4-methyl-2-(4H-pyrimidin-3-yl)benzenesulfonic acid |
|---|---|
| PubChem CID | 88618415 |
| Molecular Formula | C11H12N2O3S |
| Molecular Weight | 252.30 g/mol |
| Exact Mass | 252.06 |
| IUPAC Name | 4-methyl-2-(4H-pyrimidin-3-yl)benzenesulfonic acid |
| SMILES | Cc1ccc(S(=O)(=O)O)c(N2C=NC=CC2)c1 |
| InChI | InChI=1S/C11H12N2O3S/c1-9-3-4-11(17(14,15)16)10(7-9)13-6-2-5-12-8-13/h2-5,7-8H,6H2,1H3,(H,14,15,16) |
| InChIKey | UJOZNWVBSOPFKT-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 69.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.30 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|