About bis(sulfanyl) butanedioate;gadolinium
bis(sulfanyl) butanedioate;gadolinium (PubChem CID 88618460) has the molecular formula C4H6GdO4S2
and a molecular weight of 339.47 g/mol. Its IUPAC name is bis(sulfanyl) butanedioate;gadolinium.
Molecular Properties
| Compound Name | bis(sulfanyl) butanedioate;gadolinium |
| PubChem CID | 88618460 |
| Molecular Formula | C4H6GdO4S2 |
| Molecular Weight | 339.47 g/mol |
| Exact Mass | 339.89 |
| IUPAC Name | bis(sulfanyl) butanedioate;gadolinium |
| SMILES | O=C(CCC(=O)OS)OS.[Gd] |
| InChI | InChI=1S/C4H6O4S2.Gd/c5-3(7-9)1-2-4(6)8-10;/h9-10H,1-2H2; |
| InChIKey | SJQLBJRWKIYNMM-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 52.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.47 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze bis(sulfanyl) butanedioate;gadolinium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(sulfanyl) butanedioate;gadolinium?
The IUPAC name of bis(sulfanyl) butanedioate;gadolinium (CID 88618460) is bis(sulfanyl) butanedioate;gadolinium.
What is the SMILES notation for bis(sulfanyl) butanedioate;gadolinium?
The canonical SMILES for bis(sulfanyl) butanedioate;gadolinium is O=C(CCC(=O)OS)OS.[Gd].
What is the InChIKey of bis(sulfanyl) butanedioate;gadolinium?
The InChIKey is SJQLBJRWKIYNMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6O4S2.Gd/c5-3(7-9)1-2-4(6)8-10;/h9-10H,1-2H2;.
What are the key properties of bis(sulfanyl) butanedioate;gadolinium?
bis(sulfanyl) butanedioate;gadolinium has a molecular weight of 339.47 g/mol, XLogP of 0.54, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(sulfanyl) butanedioate;gadolinium is sourced from PubChem (CID 88618460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).