About dimethyltin(2+);sulfanyl 2-hydroxyacetate
dimethyltin(2+);sulfanyl 2-hydroxyacetate (PubChem CID 19434703) has the molecular formula C4H10O3SSn+2
and a molecular weight of 256.90 g/mol. Its IUPAC name is dimethyltin(2+);sulfanyl 2-hydroxyacetate.
Molecular Properties
| Compound Name | dimethyltin(2+);sulfanyl 2-hydroxyacetate |
| PubChem CID | 19434703 |
| Molecular Formula | C4H10O3SSn+2 |
| Molecular Weight | 256.90 g/mol |
| Exact Mass | 257.94 |
| IUPAC Name | dimethyltin(2+);sulfanyl 2-hydroxyacetate |
| SMILES | C[Sn+2]C.O=C(CO)OS |
| InChI | InChI=1S/C2H4O3S.2CH3.Sn/c3-1-2(4)5-6;;;/h3,6H,1H2;2*1H3;/q;;;+2 |
| InChIKey | DJDBQOWHQLXXBM-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.90 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze dimethyltin(2+);sulfanyl 2-hydroxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyltin(2+);sulfanyl 2-hydroxyacetate?
The IUPAC name of dimethyltin(2+);sulfanyl 2-hydroxyacetate (CID 19434703) is dimethyltin(2+);sulfanyl 2-hydroxyacetate.
What is the SMILES notation for dimethyltin(2+);sulfanyl 2-hydroxyacetate?
The canonical SMILES for dimethyltin(2+);sulfanyl 2-hydroxyacetate is C[Sn+2]C.O=C(CO)OS.
What is the InChIKey of dimethyltin(2+);sulfanyl 2-hydroxyacetate?
The InChIKey is DJDBQOWHQLXXBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H4O3S.2CH3.Sn/c3-1-2(4)5-6;;;/h3,6H,1H2;2*1H3;/q;;;+2.
What are the key properties of dimethyltin(2+);sulfanyl 2-hydroxyacetate?
dimethyltin(2+);sulfanyl 2-hydroxyacetate has a molecular weight of 256.90 g/mol, XLogP of 0.15, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyltin(2+);sulfanyl 2-hydroxyacetate is sourced from PubChem (CID 19434703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).