About phosphanyl 2-hydroxyacetate
phosphanyl 2-hydroxyacetate (PubChem CID 58716328) has the molecular formula C2H5O3P
and a molecular weight of 108.03 g/mol. Its IUPAC name is phosphanyl 2-hydroxyacetate.
Molecular Properties
| Compound Name | phosphanyl 2-hydroxyacetate |
| PubChem CID | 58716328 |
| Molecular Formula | C2H5O3P |
| Molecular Weight | 108.03 g/mol |
| Exact Mass | 108.00 |
| IUPAC Name | phosphanyl 2-hydroxyacetate |
| SMILES | O=C(CO)OP |
| InChI | InChI=1S/C2H5O3P/c3-1-2(4)5-6/h3H,1,6H2 |
| InChIKey | CIDWFSAEOQHODA-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 108.03 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze phosphanyl 2-hydroxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phosphanyl 2-hydroxyacetate?
The IUPAC name of phosphanyl 2-hydroxyacetate (CID 58716328) is phosphanyl 2-hydroxyacetate.
What is the SMILES notation for phosphanyl 2-hydroxyacetate?
The canonical SMILES for phosphanyl 2-hydroxyacetate is O=C(CO)OP.
What is the InChIKey of phosphanyl 2-hydroxyacetate?
The InChIKey is CIDWFSAEOQHODA-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H5O3P/c3-1-2(4)5-6/h3H,1,6H2.
What are the key properties of phosphanyl 2-hydroxyacetate?
phosphanyl 2-hydroxyacetate has a molecular weight of 108.03 g/mol, XLogP of -0.69, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for phosphanyl 2-hydroxyacetate is sourced from PubChem (CID 58716328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).