About silyl 2-hydroxyacetate
silyl 2-hydroxyacetate (PubChem CID 123398347) has the molecular formula C2H6O3Si
and a molecular weight of 106.15 g/mol. Its IUPAC name is silyl 2-hydroxyacetate.
Molecular Properties
| Compound Name | silyl 2-hydroxyacetate |
| PubChem CID | 123398347 |
| Molecular Formula | C2H6O3Si |
| Molecular Weight | 106.15 g/mol |
| Exact Mass | 106.01 |
| IUPAC Name | silyl 2-hydroxyacetate |
| SMILES | O=C(CO)O[SiH3] |
| InChI | InChI=1S/C2H6O3Si/c3-1-2(4)5-6/h3H,1H2,6H3 |
| InChIKey | JXVODLXEFRTJMW-UHFFFAOYSA-N |
| XLogP | -2.20 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 106.15 |
| LogP ≤ 5 | -2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze silyl 2-hydroxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of silyl 2-hydroxyacetate?
The IUPAC name of silyl 2-hydroxyacetate (CID 123398347) is silyl 2-hydroxyacetate.
What is the SMILES notation for silyl 2-hydroxyacetate?
The canonical SMILES for silyl 2-hydroxyacetate is O=C(CO)O[SiH3].
What is the InChIKey of silyl 2-hydroxyacetate?
The InChIKey is JXVODLXEFRTJMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H6O3Si/c3-1-2(4)5-6/h3H,1H2,6H3.
What are the key properties of silyl 2-hydroxyacetate?
silyl 2-hydroxyacetate has a molecular weight of 106.15 g/mol, XLogP of -2.20, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for silyl 2-hydroxyacetate is sourced from PubChem (CID 123398347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).