C25H38ClNO2 — CID 88620305
benzyl-(3,3-dimethyl-2-phenoxyoctoxy)-dimethylazanium chloride (PubChem CID 88620305) has the molecular formula C25H38ClNO2 and a molecular weight of 420.04 g/mol. Its IUPAC name is benzyl-(3,3-dimethyl-2-phenoxyoctoxy)-dimethylazanium chloride.
| Compound Name | benzyl-(3,3-dimethyl-2-phenoxyoctoxy)-dimethylazanium chloride |
|---|---|
| PubChem CID | 88620305 |
| Molecular Formula | C25H38ClNO2 |
| Molecular Weight | 420.04 g/mol |
| Exact Mass | 419.26 |
| IUPAC Name | benzyl-(3,3-dimethyl-2-phenoxyoctoxy)-dimethylazanium chloride |
| SMILES | CCCCCC(C)(C)C(CO[N+](C)(C)Cc1ccccc1)Oc1ccccc1.[Cl-] |
| InChI | InChI=1S/C25H38NO2.ClH/c1-6-7-14-19-25(2,3)24(28-23-17-12-9-13-18-23)21-27-26(4,5)20-22-15-10-8-11-16-22;/h8-13,15-18,24H,6-7,14,19-21H2,1-5H3;1H/q+1;/p-1 |
| InChIKey | NBKUOMGDCBDDRE-UHFFFAOYSA-M |
| XLogP | 3.25 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.04 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|