C24H44N2O7 — CID 88621823
N,N',N'-tris[4-(oxiran-2-ylmethoxy)butyl]propanehydrazide (PubChem CID 88621823) has the molecular formula C24H44N2O7 and a molecular weight of 472.62 g/mol. Its IUPAC name is N,N',N'-tris[4-(oxiran-2-ylmethoxy)butyl]propanehydrazide.
| Compound Name | N,N',N'-tris[4-(oxiran-2-ylmethoxy)butyl]propanehydrazide |
|---|---|
| PubChem CID | 88621823 |
| Molecular Formula | C24H44N2O7 |
| Molecular Weight | 472.62 g/mol |
| Exact Mass | 472.31 |
| IUPAC Name | N,N',N'-tris[4-(oxiran-2-ylmethoxy)butyl]propanehydrazide |
| SMILES | CCC(=O)N(CCCCOCC1CO1)N(CCCCOCC1CO1)CCCCOCC1CO1 |
| InChI | InChI=1S/C24H44N2O7/c1-2-24(27)26(11-5-8-14-30-17-23-20-33-23)25(9-3-6-12-28-15-21-18-31-21)10-4-7-13-29-16-22-19-32-22/h21-23H,2-20H2,1H3 |
| InChIKey | NKBRCINBVHBVIZ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 88.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.62 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|