C10H9N3O2 — CID 88622378
N-hydroxy-7-methyl-1,8-naphthyridine-3-carboxamide (PubChem CID 88622378) has the molecular formula C10H9N3O2 and a molecular weight of 203.20 g/mol. Its IUPAC name is N-hydroxy-7-methyl-1,8-naphthyridine-3-carboxamide.
| Compound Name | N-hydroxy-7-methyl-1,8-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 88622378 |
| Molecular Formula | C10H9N3O2 |
| Molecular Weight | 203.20 g/mol |
| Exact Mass | 203.07 |
| IUPAC Name | N-hydroxy-7-methyl-1,8-naphthyridine-3-carboxamide |
| SMILES | Cc1ccc2cc(C(=O)NO)cnc2n1 |
| InChI | InChI=1S/C10H9N3O2/c1-6-2-3-7-4-8(10(14)13-15)5-11-9(7)12-6/h2-5,15H,1H3,(H,13,14) |
| InChIKey | XLZVWQWOYHEUJE-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.20 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|