C6H10N2O2 — CID 88625117
N-(2-hydroxyiminoethyl)-2-methylprop-2-enamide (PubChem CID 88625117) has the molecular formula C6H10N2O2 and a molecular weight of 142.16 g/mol. Its IUPAC name is N-(2-hydroxyiminoethyl)-2-methylprop-2-enamide.
| Compound Name | N-(2-hydroxyiminoethyl)-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 88625117 |
| Molecular Formula | C6H10N2O2 |
| Molecular Weight | 142.16 g/mol |
| Exact Mass | 142.07 |
| IUPAC Name | N-(2-hydroxyiminoethyl)-2-methylprop-2-enamide |
| SMILES | C=C(C)C(=O)NCC=NO |
| InChI | InChI=1S/C6H10N2O2/c1-5(2)6(9)7-3-4-8-10/h4,10H,1,3H2,2H3,(H,7,9) |
| InChIKey | ZJJQVBSSQNHKFT-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.16 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|