C18H23N2O+ — CID 8862566
N-(2,3-dimethylphenyl)-2-(5-ethyl-2-methylpyridin-1-ium-1-yl)acetamide (PubChem CID 8862566) has the molecular formula C18H23N2O+ and a molecular weight of 283.39 g/mol. Its IUPAC name is N-(2,3-dimethylphenyl)-2-(5-ethyl-2-methylpyridin-1-ium-1-yl)acetamide.
| Compound Name | N-(2,3-dimethylphenyl)-2-(5-ethyl-2-methylpyridin-1-ium-1-yl)acetamide |
|---|---|
| PubChem CID | 8862566 |
| Molecular Formula | C18H23N2O+ |
| Molecular Weight | 283.39 g/mol |
| Exact Mass | 283.18 |
| IUPAC Name | N-(2,3-dimethylphenyl)-2-(5-ethyl-2-methylpyridin-1-ium-1-yl)acetamide |
| SMILES | CCc1ccc(C)[n+](CC(=O)Nc2cccc(C)c2C)c1 |
| InChI | InChI=1S/C18H22N2O/c1-5-16-10-9-14(3)20(11-16)12-18(21)19-17-8-6-7-13(2)15(17)4/h6-11H,5,12H2,1-4H3/p+1 |
| InChIKey | WBNMKEUJDKHUSF-UHFFFAOYSA-O |
| XLogP | 3.10 |
| TPSA | 32.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.39 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|