C23H17F2NO4 — CID 8863022
2-[4-[(E)-3-[1-(difluoromethoxy)naphthalen-2-yl]-3-oxoprop-1-enyl]-2-methoxyphenoxy]acetonitrile (PubChem CID 8863022) has the molecular formula C23H17F2NO4 and a molecular weight of 409.39 g/mol. Its IUPAC name is 2-[4-[(E)-3-[1-(difluoromethoxy)naphthalen-2-yl]-3-oxoprop-1-enyl]-2-methoxyphenoxy]acetonitrile.
| Compound Name | 2-[4-[(E)-3-[1-(difluoromethoxy)naphthalen-2-yl]-3-oxoprop-1-enyl]-2-methoxyphenoxy]acetonitrile |
|---|---|
| PubChem CID | 8863022 |
| Molecular Formula | C23H17F2NO4 |
| Molecular Weight | 409.39 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | 2-[4-[(E)-3-[1-(difluoromethoxy)naphthalen-2-yl]-3-oxoprop-1-enyl]-2-methoxyphenoxy]acetonitrile |
| SMILES | COc1cc(/C=C/C(=O)c2ccc3ccccc3c2OC(F)F)ccc1OCC#N |
| InChI | InChI=1S/C23H17F2NO4/c1-28-21-14-15(7-11-20(21)29-13-12-26)6-10-19(27)18-9-8-16-4-2-3-5-17(16)22(18)30-23(24)25/h2-11,14,23H,13H2,1H3/b10-6+ |
| InChIKey | XQASVLKHYQKMQJ-UXBLZVDNSA-N |
| XLogP | 5.25 |
| TPSA | 68.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.39 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|