C23H24N2O6 — CID 88630522
ethyl 2-[[10-(2-ethoxy-2-oxoethoxy)imino-8-tricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaenylidene]amino]oxyacetate (PubChem CID 88630522) has the molecular formula C23H24N2O6 and a molecular weight of 424.45 g/mol. Its IUPAC name is ethyl 2-[[10-(2-ethoxy-2-oxoethoxy)imino-8-tricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaenylidene]amino]oxyacetate.
| Compound Name | ethyl 2-[[10-(2-ethoxy-2-oxoethoxy)imino-8-tricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaenylidene]amino]oxyacetate |
|---|---|
| PubChem CID | 88630522 |
| Molecular Formula | C23H24N2O6 |
| Molecular Weight | 424.45 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | ethyl 2-[[10-(2-ethoxy-2-oxoethoxy)imino-8-tricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaenylidene]amino]oxyacetate |
| SMILES | CCOC(=O)CON=C1CC(=NOCC(=O)OCC)c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C23H24N2O6/c1-3-28-22(26)14-30-24-20-13-21(25-31-15-23(27)29-4-2)19-12-8-6-10-17(19)16-9-5-7-11-18(16)20/h5-12H,3-4,13-15H2,1-2H3 |
| InChIKey | OLPQEVXZTOCSIR-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 95.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.45 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|