C17H13N5O4 — CID 76577927
ethyl 2-[(3-carbamoyl-2-cyanoindeno[1,2-b]pyrazin-9-ylidene)amino]oxyacetate (PubChem CID 76577927) has the molecular formula C17H13N5O4 and a molecular weight of 351.32 g/mol. Its IUPAC name is ethyl 2-[(3-carbamoyl-2-cyanoindeno[1,2-b]pyrazin-9-ylidene)amino]oxyacetate.
| Compound Name | ethyl 2-[(3-carbamoyl-2-cyanoindeno[1,2-b]pyrazin-9-ylidene)amino]oxyacetate |
|---|---|
| PubChem CID | 76577927 |
| Molecular Formula | C17H13N5O4 |
| Molecular Weight | 351.32 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | ethyl 2-[(3-carbamoyl-2-cyanoindeno[1,2-b]pyrazin-9-ylidene)amino]oxyacetate |
| SMILES | CCOC(=O)CON=C1c2ccccc2-c2nc(C(N)=O)c(C#N)nc21 |
| InChI | InChI=1S/C17H13N5O4/c1-2-25-12(23)8-26-22-14-10-6-4-3-5-9(10)13-16(14)20-11(7-18)15(21-13)17(19)24/h3-6H,2,8H2,1H3,(H2,19,24) |
| InChIKey | MKOMBJXMDVFGAE-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 140.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.32 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|