C13H6N4O3 — CID 67059693
(2-cyano-9-oxoindeno[1,2-b]pyrazin-3-yl) carbamate (PubChem CID 67059693) has the molecular formula C13H6N4O3 and a molecular weight of 266.22 g/mol. Its IUPAC name is (2-cyano-9-oxoindeno[1,2-b]pyrazin-3-yl) carbamate.
| Compound Name | (2-cyano-9-oxoindeno[1,2-b]pyrazin-3-yl) carbamate |
|---|---|
| PubChem CID | 67059693 |
| Molecular Formula | C13H6N4O3 |
| Molecular Weight | 266.22 g/mol |
| Exact Mass | 266.04 |
| IUPAC Name | (2-cyano-9-oxoindeno[1,2-b]pyrazin-3-yl) carbamate |
| SMILES | N#Cc1nc2c(nc1OC(N)=O)-c1ccccc1C2=O |
| InChI | InChI=1S/C13H6N4O3/c14-5-8-12(20-13(15)19)17-9-6-3-1-2-4-7(6)11(18)10(9)16-8/h1-4H,(H2,15,19) |
| InChIKey | GFVUPEHVRGVQBP-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 118.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.22 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |