C13H3IN4O — CID 70987426
7-iodo-9-oxoindeno[1,2-b]pyrazine-2,3-dicarbonitrile (PubChem CID 70987426) has the molecular formula C13H3IN4O and a molecular weight of 358.10 g/mol. Its IUPAC name is 7-iodo-9-oxoindeno[1,2-b]pyrazine-2,3-dicarbonitrile.
| Compound Name | 7-iodo-9-oxoindeno[1,2-b]pyrazine-2,3-dicarbonitrile |
|---|---|
| PubChem CID | 70987426 |
| Molecular Formula | C13H3IN4O |
| Molecular Weight | 358.10 g/mol |
| Exact Mass | 357.94 |
| IUPAC Name | 7-iodo-9-oxoindeno[1,2-b]pyrazine-2,3-dicarbonitrile |
| SMILES | N#Cc1nc2c(nc1C#N)-c1ccc(I)cc1C2=O |
| InChI | InChI=1S/C13H3IN4O/c14-6-1-2-7-8(3-6)13(19)12-11(7)17-9(4-15)10(5-16)18-12/h1-3H |
| InChIKey | MHXGLGIKNAVHQL-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 90.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.10 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|