C20H9N3O — CID 155549898
9-oxo-3-(2-phenylethynyl)indeno[1,2-b]pyrazine-2-carbonitrile (PubChem CID 155549898) has the molecular formula C20H9N3O and a molecular weight of 307.31 g/mol. Its IUPAC name is 9-oxo-3-(2-phenylethynyl)indeno[1,2-b]pyrazine-2-carbonitrile.
| Compound Name | 9-oxo-3-(2-phenylethynyl)indeno[1,2-b]pyrazine-2-carbonitrile |
|---|---|
| PubChem CID | 155549898 |
| Molecular Formula | C20H9N3O |
| Molecular Weight | 307.31 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | 9-oxo-3-(2-phenylethynyl)indeno[1,2-b]pyrazine-2-carbonitrile |
| SMILES | N#Cc1nc2c(nc1C#Cc1ccccc1)-c1ccccc1C2=O |
| InChI | InChI=1S/C20H9N3O/c21-12-17-16(11-10-13-6-2-1-3-7-13)22-18-14-8-4-5-9-15(14)20(24)19(18)23-17/h1-9H |
| InChIKey | XTBCKKSJNUJCHS-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 66.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.31 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|