C18H14N6O — CID 101247882
ethyl 3-cyano-5,6-dipyridin-2-ylpyrazine-2-carboximidate (PubChem CID 101247882) has the molecular formula C18H14N6O and a molecular weight of 330.35 g/mol. Its IUPAC name is ethyl 3-cyano-5,6-dipyridin-2-ylpyrazine-2-carboximidate.
| Compound Name | ethyl 3-cyano-5,6-dipyridin-2-ylpyrazine-2-carboximidate |
|---|---|
| PubChem CID | 101247882 |
| Molecular Formula | C18H14N6O |
| Molecular Weight | 330.35 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | ethyl 3-cyano-5,6-dipyridin-2-ylpyrazine-2-carboximidate |
| SMILES | [H]/N=C(\OCC)c1nc(-c2ccccn2)c(-c2ccccn2)nc1C#N |
| InChI | InChI=1S/C18H14N6O/c1-2-25-18(20)17-14(11-19)23-15(12-7-3-5-9-21-12)16(24-17)13-8-4-6-10-22-13/h3-10,20H,2H2,1H3/b20-18- |
| InChIKey | VPCLHLMVMSRUTO-ZZEZOPTASA-N |
| XLogP | 2.83 |
| TPSA | 108.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.35 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|