About bis(1-benzothiophen-2-yl)iodanium;oxido(dioxo)tungsten;phosphoric acid
bis(1-benzothiophen-2-yl)iodanium;oxido(dioxo)tungsten;phosphoric acid (PubChem CID 88632552) has the molecular formula C16H13IO7PS2W
and a molecular weight of 723.12 g/mol. Its IUPAC name is bis(1-benzothiophen-2-yl)iodanium;oxido(dioxo)tungsten;phosphoric acid.
Molecular Properties
| Compound Name | bis(1-benzothiophen-2-yl)iodanium;oxido(dioxo)tungsten;phosphoric acid |
| PubChem CID | 88632552 |
| Molecular Formula | C16H13IO7PS2W |
| Molecular Weight | 723.12 g/mol |
| Exact Mass | 722.84 |
| IUPAC Name | bis(1-benzothiophen-2-yl)iodanium;oxido(dioxo)tungsten;phosphoric acid |
| SMILES | O=P(O)(O)O.O=[W](=O)[O-].c1ccc2sc([I+]c3cc4ccccc4s3)cc2c1 |
| InChI | InChI=1S/C16H10IS2.H3O4P.3O.W/c1-3-7-13-11(5-1)9-15(18-13)17-16-10-12-6-2-4-8-14(12)19-16;1-5(2,3)4;;;;/h1-10H;(H3,1,2,3,4);;;;/q+1;;;;-1; |
| InChIKey | VOIXEXUVEBBSJO-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 134.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 723.12 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze bis(1-benzothiophen-2-yl)iodanium;oxido(dioxo)tungsten;phosphoric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(1-benzothiophen-2-yl)iodanium;oxido(dioxo)tungsten;phosphoric acid?
The IUPAC name of bis(1-benzothiophen-2-yl)iodanium;oxido(dioxo)tungsten;phosphoric acid (CID 88632552) is bis(1-benzothiophen-2-yl)iodanium;oxido(dioxo)tungsten;phosphoric acid.
What is the SMILES notation for bis(1-benzothiophen-2-yl)iodanium;oxido(dioxo)tungsten;phosphoric acid?
The canonical SMILES for bis(1-benzothiophen-2-yl)iodanium;oxido(dioxo)tungsten;phosphoric acid is O=P(O)(O)O.O=[W](=O)[O-].c1ccc2sc([I+]c3cc4ccccc4s3)cc2c1.
What is the InChIKey of bis(1-benzothiophen-2-yl)iodanium;oxido(dioxo)tungsten;phosphoric acid?
The InChIKey is VOIXEXUVEBBSJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10IS2.H3O4P.3O.W/c1-3-7-13-11(5-1)9-15(18-13)17-16-10-12-6-2-4-8-14(12)19-16;1-5(2,3)4;;;;/h1-10H;(H3,1,2,3,4);;;;/q+1;;;;-1;.
What are the key properties of bis(1-benzothiophen-2-yl)iodanium;oxido(dioxo)tungsten;phosphoric acid?
bis(1-benzothiophen-2-yl)iodanium;oxido(dioxo)tungsten;phosphoric acid has a molecular weight of 723.12 g/mol, XLogP of -0.11, 2 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(1-benzothiophen-2-yl)iodanium;oxido(dioxo)tungsten;phosphoric acid is sourced from PubChem (CID 88632552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).