C10H11NO6P2S2 — CID 14151783
[2-(1-benzothiophen-2-ylamino)-1-phosphono-2-sulfanylideneethyl]phosphonic acid (PubChem CID 14151783) has the molecular formula C10H11NO6P2S2 and a molecular weight of 367.28 g/mol. Its IUPAC name is [2-(1-benzothiophen-2-ylamino)-1-phosphono-2-sulfanylideneethyl]phosphonic acid.
| Compound Name | [2-(1-benzothiophen-2-ylamino)-1-phosphono-2-sulfanylideneethyl]phosphonic acid |
|---|---|
| PubChem CID | 14151783 |
| Molecular Formula | C10H11NO6P2S2 |
| Molecular Weight | 367.28 g/mol |
| Exact Mass | 366.95 |
| IUPAC Name | [2-(1-benzothiophen-2-ylamino)-1-phosphono-2-sulfanylideneethyl]phosphonic acid |
| SMILES | O=P(O)(O)C(C(=S)Nc1cc2ccccc2s1)P(=O)(O)O |
| InChI | InChI=1S/C10H11NO6P2S2/c12-18(13,14)10(19(15,16)17)9(20)11-8-5-6-3-1-2-4-7(6)21-8/h1-5,10H,(H,11,20)(H2,12,13,14)(H2,15,16,17) |
| InChIKey | UGYBKYCTQUVPAN-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 127.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.28 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|