C12H17F6N2O9S4+ — CID 88632845
[(6R)-7-amino-2-carboxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-3-yl]methyl-dimethylsulfanium;bis(trifluoromethanesulfonic acid) (PubChem CID 88632845) has the molecular formula C12H17F6N2O9S4+ and a molecular weight of 575.53 g/mol. Its IUPAC name is [(6R)-7-amino-2-carboxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-3-yl]methyl-dimethylsulfanium;bis(trifluoromethanesulfonic acid).
| Compound Name | [(6R)-7-amino-2-carboxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-3-yl]methyl-dimethylsulfanium;bis(trifluoromethanesulfonic acid) |
|---|---|
| PubChem CID | 88632845 |
| Molecular Formula | C12H17F6N2O9S4+ |
| Molecular Weight | 575.53 g/mol |
| Exact Mass | 574.97 |
| IUPAC Name | [(6R)-7-amino-2-carboxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-3-yl]methyl-dimethylsulfanium;bis(trifluoromethanesulfonic acid) |
| SMILES | C[S+](C)CC1=C(C(=O)O)N2C(=O)C(N)[C@H]2SC1.O=S(=O)(O)C(F)(F)F.O=S(=O)(O)C(F)(F)F |
| InChI | InChI=1S/C10H14N2O3S2.2CHF3O3S/c1-17(2)4-5-3-16-9-6(11)8(13)12(9)7(5)10(14)15;2*2-1(3,4)8(5,6)7/h6,9H,3-4,11H2,1-2H3;2*(H,5,6,7)/p+1/t6?,9-;;/m1../s1 |
| InChIKey | BNJKMWKFUPBQRD-UZAOKQHZSA-O |
| XLogP | 0.23 |
| TPSA | 192.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.53 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|