C9H13NO6S2 — CID 88633278
3-anilinopropane-1,2-disulfonic acid (PubChem CID 88633278) has the molecular formula C9H13NO6S2 and a molecular weight of 295.34 g/mol. Its IUPAC name is 3-anilinopropane-1,2-disulfonic acid.
| Compound Name | 3-anilinopropane-1,2-disulfonic acid |
|---|---|
| PubChem CID | 88633278 |
| Molecular Formula | C9H13NO6S2 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.02 |
| IUPAC Name | 3-anilinopropane-1,2-disulfonic acid |
| SMILES | O=S(=O)(O)CC(CNc1ccccc1)S(=O)(=O)O |
| InChI | InChI=1S/C9H13NO6S2/c11-17(12,13)7-9(18(14,15)16)6-10-8-4-2-1-3-5-8/h1-5,9-10H,6-7H2,(H,11,12,13)(H,14,15,16) |
| InChIKey | DYCLCXYZEPKIAO-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|