C19H20ClFN2O6S — CID 88634370
2-[acetyl-[4-[2-[(4-chlorophenyl)sulfonylamino]ethyl]-2-fluorophenoxy]amino]propanoic acid (PubChem CID 88634370) has the molecular formula C19H20ClFN2O6S and a molecular weight of 458.90 g/mol. Its IUPAC name is 2-[acetyl-[4-[2-[(4-chlorophenyl)sulfonylamino]ethyl]-2-fluorophenoxy]amino]propanoic acid.
| Compound Name | 2-[acetyl-[4-[2-[(4-chlorophenyl)sulfonylamino]ethyl]-2-fluorophenoxy]amino]propanoic acid |
|---|---|
| PubChem CID | 88634370 |
| Molecular Formula | C19H20ClFN2O6S |
| Molecular Weight | 458.90 g/mol |
| Exact Mass | 458.07 |
| IUPAC Name | 2-[acetyl-[4-[2-[(4-chlorophenyl)sulfonylamino]ethyl]-2-fluorophenoxy]amino]propanoic acid |
| SMILES | CC(=O)N(Oc1ccc(CCNS(=O)(=O)c2ccc(Cl)cc2)cc1F)C(C)C(=O)O |
| InChI | InChI=1S/C19H20ClFN2O6S/c1-12(19(25)26)23(13(2)24)29-18-8-3-14(11-17(18)21)9-10-22-30(27,28)16-6-4-15(20)5-7-16/h3-8,11-12,22H,9-10H2,1-2H3,(H,25,26) |
| InChIKey | JGUBDISKEZCMAT-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.90 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|