C20H20F2N4OS — CID 8863669
4-[(Z)-(2,4-difluorophenyl)methylideneamino]-3-[(5-methyl-2-propan-2-ylphenoxy)methyl]-1H-1,2,4-triazole-5-thione (PubChem CID 8863669) has the molecular formula C20H20F2N4OS and a molecular weight of 402.47 g/mol. Its IUPAC name is 4-[(Z)-(2,4-difluorophenyl)methylideneamino]-3-[(5-methyl-2-propan-2-ylphenoxy)methyl]-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[(Z)-(2,4-difluorophenyl)methylideneamino]-3-[(5-methyl-2-propan-2-ylphenoxy)methyl]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 8863669 |
| Molecular Formula | C20H20F2N4OS |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | 4-[(Z)-(2,4-difluorophenyl)methylideneamino]-3-[(5-methyl-2-propan-2-ylphenoxy)methyl]-1H-1,2,4-triazole-5-thione |
| SMILES | Cc1ccc(C(C)C)c(OCc2n[nH]c(=S)n2/N=C\c2ccc(F)cc2F)c1 |
| InChI | InChI=1S/C20H20F2N4OS/c1-12(2)16-7-4-13(3)8-18(16)27-11-19-24-25-20(28)26(19)23-10-14-5-6-15(21)9-17(14)22/h4-10,12H,11H2,1-3H3,(H,25,28)/b23-10- |
| InChIKey | FWFTXPDHYKDBHC-RMORIDSASA-N |
| XLogP | 5.11 |
| TPSA | 55.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|