C19H17ClN2O — CID 88638081
(E)-1-(3-chlorophenyl)-3-[4-(1H-imidazol-2-ylmethyl)phenyl]prop-2-en-1-ol (PubChem CID 88638081) has the molecular formula C19H17ClN2O and a molecular weight of 324.81 g/mol. Its IUPAC name is (E)-1-(3-chlorophenyl)-3-[4-(1H-imidazol-2-ylmethyl)phenyl]prop-2-en-1-ol.
| Compound Name | (E)-1-(3-chlorophenyl)-3-[4-(1H-imidazol-2-ylmethyl)phenyl]prop-2-en-1-ol |
|---|---|
| PubChem CID | 88638081 |
| Molecular Formula | C19H17ClN2O |
| Molecular Weight | 324.81 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | (E)-1-(3-chlorophenyl)-3-[4-(1H-imidazol-2-ylmethyl)phenyl]prop-2-en-1-ol |
| SMILES | OC(/C=C/c1ccc(Cc2ncc[nH]2)cc1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C19H17ClN2O/c20-17-3-1-2-16(13-17)18(23)9-8-14-4-6-15(7-5-14)12-19-21-10-11-22-19/h1-11,13,18,23H,12H2,(H,21,22)/b9-8+ |
| InChIKey | OSKIJQGJZWCBLJ-CMDGGOBGSA-N |
| XLogP | 4.40 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.81 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |