C25H23BCl2N2 — CID 88515189
CID 88515189 (PubChem CID 88515189) has the molecular formula C25H23BCl2N2 and a molecular weight of 433.19 g/mol.
| Compound Name | CID 88515189 |
|---|---|
| PubChem CID | 88515189 |
| Molecular Formula | C25H23BCl2N2 |
| Molecular Weight | 433.19 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | — |
| SMILES | Cc1cccc(C)c1Cc1ncc[nH]1.[B]C(c1cccc(Cl)c1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C13H9BCl2.C12H14N2/c14-13(9-3-1-5-11(15)7-9)10-4-2-6-12(16)8-10;1-9-4-3-5-10(2)11(9)8-12-13-6-7-14-12/h1-8,13H;3-7H,8H2,1-2H3,(H,13,14) |
| InChIKey | YUELWSPSEKMHGB-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.19 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|