C26H21BF6N2 — CID 88515139
CID 88515139 (PubChem CID 88515139) has the molecular formula C26H21BF6N2 and a molecular weight of 486.27 g/mol.
| Compound Name | CID 88515139 |
|---|---|
| PubChem CID | 88515139 |
| Molecular Formula | C26H21BF6N2 |
| Molecular Weight | 486.27 g/mol |
| Exact Mass | 486.17 |
| IUPAC Name | — |
| SMILES | [B]CC(c1cccc(C(F)(F)F)c1)c1cccc(C(F)(F)F)c1.c1ccc(Cc2ncc[nH]2)cc1 |
| InChI | InChI=1S/C16H11BF6.C10H10N2/c17-9-14(10-3-1-5-12(7-10)15(18,19)20)11-4-2-6-13(8-11)16(21,22)23;1-2-4-9(5-3-1)8-10-11-6-7-12-10/h1-8,14H,9H2;1-7H,8H2,(H,11,12) |
| InChIKey | HZEJRVMGRLZZJG-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.27 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|