C28H30BFN2 — CID 88515230
CID 88515230 (PubChem CID 88515230) has the molecular formula C28H30BFN2 and a molecular weight of 424.37 g/mol.
| Compound Name | CID 88515230 |
|---|---|
| PubChem CID | 88515230 |
| Molecular Formula | C28H30BFN2 |
| Molecular Weight | 424.37 g/mol |
| Exact Mass | 424.25 |
| IUPAC Name | — |
| SMILES | CCc1cc(F)cc(Cc2ncc[nH]2)c1.[B]CCCC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H17B.C12H13FN2/c17-13-7-12-16(14-8-3-1-4-9-14)15-10-5-2-6-11-15;1-2-9-5-10(7-11(13)6-9)8-12-14-3-4-15-12/h1-6,8-11,16H,7,12-13H2;3-7H,2,8H2,1H3,(H,14,15) |
| InChIKey | KDNGCQPXGRVCNR-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.37 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|