About CID 88515230
CID 88515230 (PubChem CID 88515230) has the molecular formula C28H30BFN2
and a molecular weight of 424.37 g/mol.
Molecular Properties
| Compound Name | CID 88515230 |
| PubChem CID | 88515230 |
| Molecular Formula | C28H30BFN2 |
| Molecular Weight | 424.37 g/mol |
| Exact Mass | 424.25 |
| IUPAC Name | — |
| SMILES | CCc1cc(F)cc(Cc2ncc[nH]2)c1.[B]CCCC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H17B.C12H13FN2/c17-13-7-12-16(14-8-3-1-4-9-14)15-10-5-2-6-11-15;1-2-9-5-10(7-11(13)6-9)8-12-14-3-4-15-12/h1-6,8-11,16H,7,12-13H2;3-7H,2,8H2,1H3,(H,14,15) |
| InChIKey | KDNGCQPXGRVCNR-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 424.37 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 88515230 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 88515230?
The IUPAC name of CID 88515230 (CID 88515230) is not available.
What is the SMILES notation for CID 88515230?
The canonical SMILES for CID 88515230 is CCc1cc(F)cc(Cc2ncc[nH]2)c1.[B]CCCC(c1ccccc1)c1ccccc1.
What is the InChIKey of CID 88515230?
The InChIKey is KDNGCQPXGRVCNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17B.C12H13FN2/c17-13-7-12-16(14-8-3-1-4-9-14)15-10-5-2-6-11-15;1-2-9-5-10(7-11(13)6-9)8-12-14-3-4-15-12/h1-6,8-11,16H,7,12-13H2;3-7H,2,8H2,1H3,(H,14,15).
What are the key properties of CID 88515230?
CID 88515230 has a molecular weight of 424.37 g/mol, XLogP of 6.89, 8 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 88515230 is sourced from PubChem (CID 88515230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).