C23H23BF6N2 — CID 88515154
CID 88515154 (PubChem CID 88515154) has the molecular formula C23H23BF6N2 and a molecular weight of 452.25 g/mol.
| Compound Name | CID 88515154 |
|---|---|
| PubChem CID | 88515154 |
| Molecular Formula | C23H23BF6N2 |
| Molecular Weight | 452.25 g/mol |
| Exact Mass | 452.19 |
| IUPAC Name | — |
| SMILES | CCc1nc[nH]c1CC.[B]CC(c1cccc(C(F)(F)F)c1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H11BF6.C7H12N2/c17-9-14(10-3-1-5-12(7-10)15(18,19)20)11-4-2-6-13(8-11)16(21,22)23;1-3-6-7(4-2)9-5-8-6/h1-8,14H,9H2;5H,3-4H2,1-2H3,(H,8,9) |
| InChIKey | AQNHVTRICOBJRQ-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.25 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|