About S-morpholin-4-yl 2-(2-phenylquinolin-4-yl)oxyethanethioate
S-morpholin-4-yl 2-(2-phenylquinolin-4-yl)oxyethanethioate (PubChem CID 88639240) has the molecular formula C21H20N2O3S
and a molecular weight of 380.47 g/mol. Its IUPAC name is S-morpholin-4-yl 2-(2-phenylquinolin-4-yl)oxyethanethioate.
Molecular Properties
| Compound Name | S-morpholin-4-yl 2-(2-phenylquinolin-4-yl)oxyethanethioate |
| PubChem CID | 88639240 |
| Molecular Formula | C21H20N2O3S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | S-morpholin-4-yl 2-(2-phenylquinolin-4-yl)oxyethanethioate |
| SMILES | O=C(COc1cc(-c2ccccc2)nc2ccccc12)SN1CCOCC1 |
| InChI | InChI=1S/C21H20N2O3S/c24-21(27-23-10-12-25-13-11-23)15-26-20-14-19(16-6-2-1-3-7-16)22-18-9-5-4-8-17(18)20/h1-9,14H,10-13,15H2 |
| InChIKey | BSYDNYLPYSCEDR-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-morpholin-4-yl 2-(2-phenylquinolin-4-yl)oxyethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-morpholin-4-yl 2-(2-phenylquinolin-4-yl)oxyethanethioate?
The IUPAC name of S-morpholin-4-yl 2-(2-phenylquinolin-4-yl)oxyethanethioate (CID 88639240) is S-morpholin-4-yl 2-(2-phenylquinolin-4-yl)oxyethanethioate.
What is the SMILES notation for S-morpholin-4-yl 2-(2-phenylquinolin-4-yl)oxyethanethioate?
The canonical SMILES for S-morpholin-4-yl 2-(2-phenylquinolin-4-yl)oxyethanethioate is O=C(COc1cc(-c2ccccc2)nc2ccccc12)SN1CCOCC1.
What is the InChIKey of S-morpholin-4-yl 2-(2-phenylquinolin-4-yl)oxyethanethioate?
The InChIKey is BSYDNYLPYSCEDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20N2O3S/c24-21(27-23-10-12-25-13-11-23)15-26-20-14-19(16-6-2-1-3-7-16)22-18-9-5-4-8-17(18)20/h1-9,14H,10-13,15H2.
What are the key properties of S-morpholin-4-yl 2-(2-phenylquinolin-4-yl)oxyethanethioate?
S-morpholin-4-yl 2-(2-phenylquinolin-4-yl)oxyethanethioate has a molecular weight of 380.47 g/mol, XLogP of 3.79, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for S-morpholin-4-yl 2-(2-phenylquinolin-4-yl)oxyethanethioate is sourced from PubChem (CID 88639240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).