About (3-hydroxy-2,2,4-trimethylpentyl) 2-ethyl-4-methyl-2-(2-methylpropyl)pentanoate
(3-hydroxy-2,2,4-trimethylpentyl) 2-ethyl-4-methyl-2-(2-methylpropyl)pentanoate (PubChem CID 88641434) has the molecular formula C20H40O3
and a molecular weight of 328.54 g/mol. Its IUPAC name is (3-hydroxy-2,2,4-trimethylpentyl) 2-ethyl-4-methyl-2-(2-methylpropyl)pentanoate.
Molecular Properties
| Compound Name | (3-hydroxy-2,2,4-trimethylpentyl) 2-ethyl-4-methyl-2-(2-methylpropyl)pentanoate |
| PubChem CID | 88641434 |
| Molecular Formula | C20H40O3 |
| Molecular Weight | 328.54 g/mol |
| Exact Mass | 328.30 |
| IUPAC Name | (3-hydroxy-2,2,4-trimethylpentyl) 2-ethyl-4-methyl-2-(2-methylpropyl)pentanoate |
| SMILES | CCC(CC(C)C)(CC(C)C)C(=O)OCC(C)(C)C(O)C(C)C |
| InChI | InChI=1S/C20H40O3/c1-10-20(11-14(2)3,12-15(4)5)18(22)23-13-19(8,9)17(21)16(6)7/h14-17,21H,10-13H2,1-9H3 |
| InChIKey | MTPWEQUFSLPKHJ-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 328.54 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3-hydroxy-2,2,4-trimethylpentyl) 2-ethyl-4-methyl-2-(2-methylpropyl)pentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-hydroxy-2,2,4-trimethylpentyl) 2-ethyl-4-methyl-2-(2-methylpropyl)pentanoate?
The IUPAC name of (3-hydroxy-2,2,4-trimethylpentyl) 2-ethyl-4-methyl-2-(2-methylpropyl)pentanoate (CID 88641434) is (3-hydroxy-2,2,4-trimethylpentyl) 2-ethyl-4-methyl-2-(2-methylpropyl)pentanoate.
What is the SMILES notation for (3-hydroxy-2,2,4-trimethylpentyl) 2-ethyl-4-methyl-2-(2-methylpropyl)pentanoate?
The canonical SMILES for (3-hydroxy-2,2,4-trimethylpentyl) 2-ethyl-4-methyl-2-(2-methylpropyl)pentanoate is CCC(CC(C)C)(CC(C)C)C(=O)OCC(C)(C)C(O)C(C)C.
What is the InChIKey of (3-hydroxy-2,2,4-trimethylpentyl) 2-ethyl-4-methyl-2-(2-methylpropyl)pentanoate?
The InChIKey is MTPWEQUFSLPKHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H40O3/c1-10-20(11-14(2)3,12-15(4)5)18(22)23-13-19(8,9)17(21)16(6)7/h14-17,21H,10-13H2,1-9H3.
What are the key properties of (3-hydroxy-2,2,4-trimethylpentyl) 2-ethyl-4-methyl-2-(2-methylpropyl)pentanoate?
(3-hydroxy-2,2,4-trimethylpentyl) 2-ethyl-4-methyl-2-(2-methylpropyl)pentanoate has a molecular weight of 328.54 g/mol, XLogP of 5.06, 10 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-hydroxy-2,2,4-trimethylpentyl) 2-ethyl-4-methyl-2-(2-methylpropyl)pentanoate is sourced from PubChem (CID 88641434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).