C14H16FN2+ — CID 8864261
1-[(3-fluorophenyl)methyl]-N,N-dimethylpyridin-1-ium-4-amine (PubChem CID 8864261) has the molecular formula C14H16FN2+ and a molecular weight of 231.29 g/mol. Its IUPAC name is 1-[(3-fluorophenyl)methyl]-N,N-dimethylpyridin-1-ium-4-amine.
| Compound Name | 1-[(3-fluorophenyl)methyl]-N,N-dimethylpyridin-1-ium-4-amine |
|---|---|
| PubChem CID | 8864261 |
| Molecular Formula | C14H16FN2+ |
| Molecular Weight | 231.29 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | 1-[(3-fluorophenyl)methyl]-N,N-dimethylpyridin-1-ium-4-amine |
| SMILES | CN(C)c1cc[n+](Cc2cccc(F)c2)cc1 |
| InChI | InChI=1S/C14H16FN2/c1-16(2)14-6-8-17(9-7-14)11-12-4-3-5-13(15)10-12/h3-10H,11H2,1-2H3/q+1 |
| InChIKey | YNAXTTLNESYMCV-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.29 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|