C16H17FN+ — CID 8876858
2-[(3-fluorophenyl)methyl]-5,6,7,8-tetrahydroisoquinolin-2-ium (PubChem CID 8876858) has the molecular formula C16H17FN+ and a molecular weight of 242.32 g/mol. Its IUPAC name is 2-[(3-fluorophenyl)methyl]-5,6,7,8-tetrahydroisoquinolin-2-ium.
| Compound Name | 2-[(3-fluorophenyl)methyl]-5,6,7,8-tetrahydroisoquinolin-2-ium |
|---|---|
| PubChem CID | 8876858 |
| Molecular Formula | C16H17FN+ |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | 2-[(3-fluorophenyl)methyl]-5,6,7,8-tetrahydroisoquinolin-2-ium |
| SMILES | Fc1cccc(C[n+]2ccc3c(c2)CCCC3)c1 |
| InChI | InChI=1S/C16H17FN/c17-16-7-3-4-13(10-16)11-18-9-8-14-5-1-2-6-15(14)12-18/h3-4,7-10,12H,1-2,5-6,11H2/q+1 |
| InChIKey | NQZXXELCSMOQLF-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|