C16H16Cl2N+ — CID 8877025
2-[(3,4-dichlorophenyl)methyl]-5,6,7,8-tetrahydroisoquinolin-2-ium (PubChem CID 8877025) has the molecular formula C16H16Cl2N+ and a molecular weight of 293.22 g/mol. Its IUPAC name is 2-[(3,4-dichlorophenyl)methyl]-5,6,7,8-tetrahydroisoquinolin-2-ium.
| Compound Name | 2-[(3,4-dichlorophenyl)methyl]-5,6,7,8-tetrahydroisoquinolin-2-ium |
|---|---|
| PubChem CID | 8877025 |
| Molecular Formula | C16H16Cl2N+ |
| Molecular Weight | 293.22 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | 2-[(3,4-dichlorophenyl)methyl]-5,6,7,8-tetrahydroisoquinolin-2-ium |
| SMILES | Clc1ccc(C[n+]2ccc3c(c2)CCCC3)cc1Cl |
| InChI | InChI=1S/C16H16Cl2N/c17-15-6-5-12(9-16(15)18)10-19-8-7-13-3-1-2-4-14(13)11-19/h5-9,11H,1-4,10H2/q+1 |
| InChIKey | LILAUAGEVFDXSX-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.22 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|