C19H31NO4 — CID 88645259
(Z)-7-[(1R,2R,3R,4S)-3-(pentoxyiminomethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid (PubChem CID 88645259) has the molecular formula C19H31NO4 and a molecular weight of 337.46 g/mol. Its IUPAC name is (Z)-7-[(1R,2R,3R,4S)-3-(pentoxyiminomethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,2R,3R,4S)-3-(pentoxyiminomethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 88645259 |
| Molecular Formula | C19H31NO4 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.23 |
| IUPAC Name | (Z)-7-[(1R,2R,3R,4S)-3-(pentoxyiminomethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid |
| SMILES | CCCCCON=C[C@H]1[C@@H](C/C=C\CCCC(=O)O)[C@H]2CC[C@@H]1O2 |
| InChI | InChI=1S/C19H31NO4/c1-2-3-8-13-23-20-14-16-15(17-11-12-18(16)24-17)9-6-4-5-7-10-19(21)22/h4,6,14-18H,2-3,5,7-13H2,1H3,(H,21,22)/b6-4-,20-14?/t15-,16+,17-,18+/m1/s1 |
| InChIKey | BAZSHTCVQKVLQR-DEKJJVNYSA-N |
| XLogP | 4.17 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|