C28H30O — CID 88645535
1-[3,4-dimethyl-5-(3-phenoxyphenyl)pent-1-yn-3-yl]-4-propan-2-ylbenzene (PubChem CID 88645535) has the molecular formula C28H30O and a molecular weight of 382.55 g/mol. Its IUPAC name is 1-[3,4-dimethyl-5-(3-phenoxyphenyl)pent-1-yn-3-yl]-4-propan-2-ylbenzene.
| Compound Name | 1-[3,4-dimethyl-5-(3-phenoxyphenyl)pent-1-yn-3-yl]-4-propan-2-ylbenzene |
|---|---|
| PubChem CID | 88645535 |
| Molecular Formula | C28H30O |
| Molecular Weight | 382.55 g/mol |
| Exact Mass | 382.23 |
| IUPAC Name | 1-[3,4-dimethyl-5-(3-phenoxyphenyl)pent-1-yn-3-yl]-4-propan-2-ylbenzene |
| SMILES | C#CC(C)(c1ccc(C(C)C)cc1)C(C)Cc1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C28H30O/c1-6-28(5,25-17-15-24(16-18-25)21(2)3)22(4)19-23-11-10-14-27(20-23)29-26-12-8-7-9-13-26/h1,7-18,20-22H,19H2,2-5H3 |
| InChIKey | SHQWDGJEBNUNSW-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.55 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|