C23H21N3O7 — CID 88651953
N-[[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-9H-fluorene-9-carboxamide (PubChem CID 88651953) has the molecular formula C23H21N3O7 and a molecular weight of 451.44 g/mol. Its IUPAC name is N-[[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-9H-fluorene-9-carboxamide.
| Compound Name | N-[[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-9H-fluorene-9-carboxamide |
|---|---|
| PubChem CID | 88651953 |
| Molecular Formula | C23H21N3O7 |
| Molecular Weight | 451.44 g/mol |
| Exact Mass | 451.14 |
| IUPAC Name | N-[[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-9H-fluorene-9-carboxamide |
| SMILES | O=C(NOC[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)[C@H](O)[C@@H]1O)C1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C23H21N3O7/c27-17-9-10-26(23(31)24-17)22-20(29)19(28)16(33-22)11-32-25-21(30)18-14-7-3-1-5-12(14)13-6-2-4-8-15(13)18/h1-10,16,18-20,22,28-29H,11H2,(H,25,30)(H,24,27,31)/t16-,19-,20-,22-/m1/s1 |
| InChIKey | NVBTXJIEZLLDMM-KREFBHGWSA-N |
| XLogP | 0.02 |
| TPSA | 142.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.44 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|