C16H12F3NO2S — CID 8865261
(2E)-3-oxo-2-(thiophen-2-ylmethylidene)-N-[2-(trifluoromethyl)phenyl]butanamide (PubChem CID 8865261) has the molecular formula C16H12F3NO2S and a molecular weight of 339.34 g/mol. Its IUPAC name is (2E)-3-oxo-2-(thiophen-2-ylmethylidene)-N-[2-(trifluoromethyl)phenyl]butanamide.
| Compound Name | (2E)-3-oxo-2-(thiophen-2-ylmethylidene)-N-[2-(trifluoromethyl)phenyl]butanamide |
|---|---|
| PubChem CID | 8865261 |
| Molecular Formula | C16H12F3NO2S |
| Molecular Weight | 339.34 g/mol |
| Exact Mass | 339.05 |
| IUPAC Name | (2E)-3-oxo-2-(thiophen-2-ylmethylidene)-N-[2-(trifluoromethyl)phenyl]butanamide |
| SMILES | CC(=O)/C(=C\c1cccs1)C(=O)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C16H12F3NO2S/c1-10(21)12(9-11-5-4-8-23-11)15(22)20-14-7-3-2-6-13(14)16(17,18)19/h2-9H,1H3,(H,20,22)/b12-9+ |
| InChIKey | QZFNMIQXTPSEQJ-FMIVXFBMSA-N |
| XLogP | 4.38 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.34 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|