C13H22O7 — CID 88652816
(2-carboxyoxy-1-hexylperoxyethyl) 2-methylprop-2-enoate (PubChem CID 88652816) has the molecular formula C13H22O7 and a molecular weight of 290.31 g/mol. Its IUPAC name is (2-carboxyoxy-1-hexylperoxyethyl) 2-methylprop-2-enoate.
| Compound Name | (2-carboxyoxy-1-hexylperoxyethyl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 88652816 |
| Molecular Formula | C13H22O7 |
| Molecular Weight | 290.31 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | (2-carboxyoxy-1-hexylperoxyethyl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(COC(=O)O)OOCCCCCC |
| InChI | InChI=1S/C13H22O7/c1-4-5-6-7-8-18-20-11(9-17-13(15)16)19-12(14)10(2)3/h11H,2,4-9H2,1,3H3,(H,15,16) |
| InChIKey | YJCNFSZOLSMPPH-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.31 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|