C16H18O4S3 — CID 88654208
methyl 4-(2-butoxy-2-oxo-1-phenylsulfanylethylidene)-1,3-dithietane-2-carboxylate (PubChem CID 88654208) has the molecular formula C16H18O4S3 and a molecular weight of 370.52 g/mol. Its IUPAC name is methyl 4-(2-butoxy-2-oxo-1-phenylsulfanylethylidene)-1,3-dithietane-2-carboxylate.
| Compound Name | methyl 4-(2-butoxy-2-oxo-1-phenylsulfanylethylidene)-1,3-dithietane-2-carboxylate |
|---|---|
| PubChem CID | 88654208 |
| Molecular Formula | C16H18O4S3 |
| Molecular Weight | 370.52 g/mol |
| Exact Mass | 370.04 |
| IUPAC Name | methyl 4-(2-butoxy-2-oxo-1-phenylsulfanylethylidene)-1,3-dithietane-2-carboxylate |
| SMILES | CCCCOC(=O)C(Sc1ccccc1)=C1SC(C(=O)OC)S1 |
| InChI | InChI=1S/C16H18O4S3/c1-3-4-10-20-13(17)12(21-11-8-6-5-7-9-11)15-22-16(23-15)14(18)19-2/h5-9,16H,3-4,10H2,1-2H3/b15-12- |
| InChIKey | UIDDWJUKHGPWEA-QINSGFPZSA-N |
| XLogP | 4.27 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.52 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|