About 4-ethenylbenzenesulfonic acid;2-ethenyl-6-methylbenzenesulfonic acid
4-ethenylbenzenesulfonic acid;2-ethenyl-6-methylbenzenesulfonic acid (PubChem CID 88655770) has the molecular formula C17H18O6S2
and a molecular weight of 382.46 g/mol. Its IUPAC name is 4-ethenylbenzenesulfonic acid;2-ethenyl-6-methylbenzenesulfonic acid.
Molecular Properties
| Compound Name | 4-ethenylbenzenesulfonic acid;2-ethenyl-6-methylbenzenesulfonic acid |
| PubChem CID | 88655770 |
| Molecular Formula | C17H18O6S2 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.05 |
| IUPAC Name | 4-ethenylbenzenesulfonic acid;2-ethenyl-6-methylbenzenesulfonic acid |
| SMILES | C=Cc1ccc(S(=O)(=O)O)cc1.C=Cc1cccc(C)c1S(=O)(=O)O |
| InChI | InChI=1S/C9H10O3S.C8H8O3S/c1-3-8-6-4-5-7(2)9(8)13(10,11)12;1-2-7-3-5-8(6-4-7)12(9,10)11/h3-6H,1H2,2H3,(H,10,11,12);2-6H,1H2,(H,9,10,11) |
| InChIKey | UKXZRFUSWCPTQY-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 4-ethenylbenzenesulfonic acid;2-ethenyl-6-methylbenzenesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethenylbenzenesulfonic acid;2-ethenyl-6-methylbenzenesulfonic acid?
The IUPAC name of 4-ethenylbenzenesulfonic acid;2-ethenyl-6-methylbenzenesulfonic acid (CID 88655770) is 4-ethenylbenzenesulfonic acid;2-ethenyl-6-methylbenzenesulfonic acid.
What is the SMILES notation for 4-ethenylbenzenesulfonic acid;2-ethenyl-6-methylbenzenesulfonic acid?
The canonical SMILES for 4-ethenylbenzenesulfonic acid;2-ethenyl-6-methylbenzenesulfonic acid is C=Cc1ccc(S(=O)(=O)O)cc1.C=Cc1cccc(C)c1S(=O)(=O)O.
What is the InChIKey of 4-ethenylbenzenesulfonic acid;2-ethenyl-6-methylbenzenesulfonic acid?
The InChIKey is UKXZRFUSWCPTQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O3S.C8H8O3S/c1-3-8-6-4-5-7(2)9(8)13(10,11)12;1-2-7-3-5-8(6-4-7)12(9,10)11/h3-6H,1H2,2H3,(H,10,11,12);2-6H,1H2,(H,9,10,11).
What are the key properties of 4-ethenylbenzenesulfonic acid;2-ethenyl-6-methylbenzenesulfonic acid?
4-ethenylbenzenesulfonic acid;2-ethenyl-6-methylbenzenesulfonic acid has a molecular weight of 382.46 g/mol, XLogP of 3.46, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethenylbenzenesulfonic acid;2-ethenyl-6-methylbenzenesulfonic acid is sourced from PubChem (CID 88655770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).