C64H119NO7 — CID 88660276
11-(aminomethyl)-11,12,13,13-tetrakis(decanoyl)-12-hydroxytricosane-10,14-dione (PubChem CID 88660276) has the molecular formula C64H119NO7 and a molecular weight of 1014.66 g/mol. Its IUPAC name is 11-(aminomethyl)-11,12,13,13-tetrakis(decanoyl)-12-hydroxytricosane-10,14-dione.
| Compound Name | 11-(aminomethyl)-11,12,13,13-tetrakis(decanoyl)-12-hydroxytricosane-10,14-dione |
|---|---|
| PubChem CID | 88660276 |
| Molecular Formula | C64H119NO7 |
| Molecular Weight | 1014.66 g/mol |
| Exact Mass | 1013.90 |
| IUPAC Name | 11-(aminomethyl)-11,12,13,13-tetrakis(decanoyl)-12-hydroxytricosane-10,14-dione |
| SMILES | CCCCCCCCCC(=O)C(CN)(C(=O)CCCCCCCCC)C(O)(C(=O)CCCCCCCCC)C(C(=O)CCCCCCCCC)(C(=O)CCCCCCCCC)C(=O)CCCCCCCCC |
| InChI | InChI=1S/C64H119NO7/c1-7-13-19-25-31-37-43-49-56(66)62(55-65,57(67)50-44-38-32-26-20-14-8-2)64(72,61(71)54-48-42-36-30-24-18-12-6)63(58(68)51-45-39-33-27-21-15-9-3,59(69)52-46-40-34-28-22-16-10-4)60(70)53-47-41-35-29-23-17-11-5/h72H,7-55,65H2,1-6H3 |
| InChIKey | YXPGBQKGOVSDBZ-UHFFFAOYSA-N |
| XLogP | 17.91 |
| TPSA | 148.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 57 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1014.66 |
| LogP ≤ 5 | 17.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|