C34H31ClN6O4 — CID 88662820
4-chloro-3-nitroquinoline;3-nitro-N-(1-phenylethyl)quinolin-4-amine;1-phenylethanamine (PubChem CID 88662820) has the molecular formula C34H31ClN6O4 and a molecular weight of 623.11 g/mol. Its IUPAC name is 4-chloro-3-nitroquinoline;3-nitro-N-(1-phenylethyl)quinolin-4-amine;1-phenylethanamine.
| Compound Name | 4-chloro-3-nitroquinoline;3-nitro-N-(1-phenylethyl)quinolin-4-amine;1-phenylethanamine |
|---|---|
| PubChem CID | 88662820 |
| Molecular Formula | C34H31ClN6O4 |
| Molecular Weight | 623.11 g/mol |
| Exact Mass | 622.21 |
| IUPAC Name | 4-chloro-3-nitroquinoline;3-nitro-N-(1-phenylethyl)quinolin-4-amine;1-phenylethanamine |
| SMILES | CC(N)c1ccccc1.CC(Nc1c([N+](=O)[O-])cnc2ccccc12)c1ccccc1.O=[N+]([O-])c1cnc2ccccc2c1Cl |
| InChI | InChI=1S/C17H15N3O2.C9H5ClN2O2.C8H11N/c1-12(13-7-3-2-4-8-13)19-17-14-9-5-6-10-15(14)18-11-16(17)20(21)22;10-9-6-3-1-2-4-7(6)11-5-8(9)12(13)14;1-7(9)8-5-3-2-4-6-8/h2-12H,1H3,(H,18,19);1-5H;2-7H,9H2,1H3 |
| InChIKey | RECSOMYFEZASKY-UHFFFAOYSA-N |
| XLogP | 8.82 |
| TPSA | 150.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.11 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|