C14H17N3O3 — CID 88666159
1-(oxan-2-yl)-4-[[(2S)-oxiran-2-yl]methoxy]benzotriazole (PubChem CID 88666159) has the molecular formula C14H17N3O3 and a molecular weight of 275.31 g/mol. Its IUPAC name is 1-(oxan-2-yl)-4-[[(2S)-oxiran-2-yl]methoxy]benzotriazole.
| Compound Name | 1-(oxan-2-yl)-4-[[(2S)-oxiran-2-yl]methoxy]benzotriazole |
|---|---|
| PubChem CID | 88666159 |
| Molecular Formula | C14H17N3O3 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 1-(oxan-2-yl)-4-[[(2S)-oxiran-2-yl]methoxy]benzotriazole |
| SMILES | c1cc(OC[C@@H]2CO2)c2nnn(C3CCCCO3)c2c1 |
| InChI | InChI=1S/C14H17N3O3/c1-2-7-18-13(6-1)17-11-4-3-5-12(14(11)15-16-17)20-9-10-8-19-10/h3-5,10,13H,1-2,6-9H2/t10-,13?/m0/s1 |
| InChIKey | IGOHOAPJBZPBKF-NKUHCKNESA-N |
| XLogP | 1.91 |
| TPSA | 61.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|