C7H13N3O5 — CID 88668972
2-[(2-aminoacetyl)-(2-amino-3-hydroxypropanoyl)amino]acetic acid (PubChem CID 88668972) has the molecular formula C7H13N3O5 and a molecular weight of 219.20 g/mol. Its IUPAC name is 2-[(2-aminoacetyl)-(2-amino-3-hydroxypropanoyl)amino]acetic acid.
| Compound Name | 2-[(2-aminoacetyl)-(2-amino-3-hydroxypropanoyl)amino]acetic acid |
|---|---|
| PubChem CID | 88668972 |
| Molecular Formula | C7H13N3O5 |
| Molecular Weight | 219.20 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | 2-[(2-aminoacetyl)-(2-amino-3-hydroxypropanoyl)amino]acetic acid |
| SMILES | NCC(=O)N(CC(=O)O)C(=O)C(N)CO |
| InChI | InChI=1S/C7H13N3O5/c8-1-5(12)10(2-6(13)14)7(15)4(9)3-11/h4,11H,1-3,8-9H2,(H,13,14) |
| InChIKey | UUCWKUGSCTWHQA-UHFFFAOYSA-N |
| XLogP | -3.30 |
| TPSA | 146.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.20 |
| LogP ≤ 5 | -3.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |