C20H18F6N4O6S2+2 — CID 88671804
N-[1,6-bis(1-methylpyridin-1-ium-2-yl)-3,4-dioxo-5-(trifluoromethylsulfonylimino)hexan-2-ylidene]-1,1,1-trifluoromethanesulfonamide (PubChem CID 88671804) has the molecular formula C20H18F6N4O6S2+2 and a molecular weight of 588.51 g/mol. Its IUPAC name is N-[1,6-bis(1-methylpyridin-1-ium-2-yl)-3,4-dioxo-5-(trifluoromethylsulfonylimino)hexan-2-ylidene]-1,1,1-trifluoromethanesulfonamide.
| Compound Name | N-[1,6-bis(1-methylpyridin-1-ium-2-yl)-3,4-dioxo-5-(trifluoromethylsulfonylimino)hexan-2-ylidene]-1,1,1-trifluoromethanesulfonamide |
|---|---|
| PubChem CID | 88671804 |
| Molecular Formula | C20H18F6N4O6S2+2 |
| Molecular Weight | 588.51 g/mol |
| Exact Mass | 588.06 |
| IUPAC Name | N-[1,6-bis(1-methylpyridin-1-ium-2-yl)-3,4-dioxo-5-(trifluoromethylsulfonylimino)hexan-2-ylidene]-1,1,1-trifluoromethanesulfonamide |
| SMILES | C[n+]1ccccc1CC(=NS(=O)(=O)C(F)(F)F)C(=O)C(=O)C(Cc1cccc[n+]1C)=NS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C20H18F6N4O6S2/c1-29-9-5-3-7-13(29)11-15(27-37(33,34)19(21,22)23)17(31)18(32)16(28-38(35,36)20(24,25)26)12-14-8-4-6-10-30(14)2/h3-10H,11-12H2,1-2H3/q+2 |
| InChIKey | DYFNSDOUCLPYHF-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 134.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.51 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|