C13H21Cl — CID 88672881
(5E,9E)-11-chloro-11-methyldodeca-1,5,9-triene (PubChem CID 88672881) has the molecular formula C13H21Cl and a molecular weight of 212.76 g/mol. Its IUPAC name is (5E,9E)-11-chloro-11-methyldodeca-1,5,9-triene.
| Compound Name | (5E,9E)-11-chloro-11-methyldodeca-1,5,9-triene |
|---|---|
| PubChem CID | 88672881 |
| Molecular Formula | C13H21Cl |
| Molecular Weight | 212.76 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | (5E,9E)-11-chloro-11-methyldodeca-1,5,9-triene |
| SMILES | C=CCC/C=C/CC/C=C/C(C)(C)Cl |
| InChI | InChI=1S/C13H21Cl/c1-4-5-6-7-8-9-10-11-12-13(2,3)14/h4,7-8,11-12H,1,5-6,9-10H2,2-3H3/b8-7+,12-11+ |
| InChIKey | FFVYSLWSUCNSCJ-NJHWEWLZSA-N |
| XLogP | 4.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.76 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|