C19H28Cl3NO2 — CID 88677114
1-cyclohexyl-4-(3,5-dichloro-2-methoxyphenoxy)hexan-1-imine;hydrochloride (PubChem CID 88677114) has the molecular formula C19H28Cl3NO2 and a molecular weight of 408.80 g/mol. Its IUPAC name is 1-cyclohexyl-4-(3,5-dichloro-2-methoxyphenoxy)hexan-1-imine;hydrochloride.
| Compound Name | 1-cyclohexyl-4-(3,5-dichloro-2-methoxyphenoxy)hexan-1-imine;hydrochloride |
|---|---|
| PubChem CID | 88677114 |
| Molecular Formula | C19H28Cl3NO2 |
| Molecular Weight | 408.80 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | 1-cyclohexyl-4-(3,5-dichloro-2-methoxyphenoxy)hexan-1-imine;hydrochloride |
| SMILES | Cl.[H]/N=C(/CCC(CC)Oc1cc(Cl)cc(Cl)c1OC)C1CCCCC1 |
| InChI | InChI=1S/C19H27Cl2NO2.ClH/c1-3-15(9-10-17(22)13-7-5-4-6-8-13)24-18-12-14(20)11-16(21)19(18)23-2;/h11-13,15,22H,3-10H2,1-2H3;1H/b22-17-; |
| InChIKey | PXGWUNLKJDCIGQ-JJECXDOKSA-N |
| XLogP | 6.96 |
| TPSA | 42.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.80 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|