C19H17Cl6N3S2 — CID 88679275
2-[1-(1H-imidazol-2-yl)ethylamino]ethanethiol;1,3,5-trichloro-2-(2,4,6-trichlorophenyl)sulfanylbenzene (PubChem CID 88679275) has the molecular formula C19H17Cl6N3S2 and a molecular weight of 564.22 g/mol. Its IUPAC name is 2-[1-(1H-imidazol-2-yl)ethylamino]ethanethiol;1,3,5-trichloro-2-(2,4,6-trichlorophenyl)sulfanylbenzene.
| Compound Name | 2-[1-(1H-imidazol-2-yl)ethylamino]ethanethiol;1,3,5-trichloro-2-(2,4,6-trichlorophenyl)sulfanylbenzene |
|---|---|
| PubChem CID | 88679275 |
| Molecular Formula | C19H17Cl6N3S2 |
| Molecular Weight | 564.22 g/mol |
| Exact Mass | 560.90 |
| IUPAC Name | 2-[1-(1H-imidazol-2-yl)ethylamino]ethanethiol;1,3,5-trichloro-2-(2,4,6-trichlorophenyl)sulfanylbenzene |
| SMILES | CC(NCCS)c1ncc[nH]1.Clc1cc(Cl)c(Sc2c(Cl)cc(Cl)cc2Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H4Cl6S.C7H13N3S/c13-5-1-7(15)11(8(16)2-5)19-12-9(17)3-6(14)4-10(12)18;1-6(8-4-5-11)7-9-2-3-10-7/h1-4H;2-3,6,8,11H,4-5H2,1H3,(H,9,10) |
| InChIKey | PWCMTQBCIGEHMV-UHFFFAOYSA-N |
| XLogP | 8.75 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.22 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|