About hexyl(dimethyl)sulfanium;methyl sulfate
hexyl(dimethyl)sulfanium;methyl sulfate (PubChem CID 88683153) has the molecular formula C9H22O4S2
and a molecular weight of 258.40 g/mol. Its IUPAC name is hexyl(dimethyl)sulfanium;methyl sulfate.
Molecular Properties
| Compound Name | hexyl(dimethyl)sulfanium;methyl sulfate |
| PubChem CID | 88683153 |
| Molecular Formula | C9H22O4S2 |
| Molecular Weight | 258.40 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | hexyl(dimethyl)sulfanium;methyl sulfate |
| SMILES | CCCCCC[S+](C)C.COS(=O)(=O)[O-] |
| InChI | InChI=1S/C8H19S.CH4O4S/c1-4-5-6-7-8-9(2)3;1-5-6(2,3)4/h4-8H2,1-3H3;1H3,(H,2,3,4)/q+1;/p-1 |
| InChIKey | KXDLQKAJJCMXID-UHFFFAOYSA-M |
| XLogP | 1.54 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.40 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze hexyl(dimethyl)sulfanium;methyl sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexyl(dimethyl)sulfanium;methyl sulfate?
The IUPAC name of hexyl(dimethyl)sulfanium;methyl sulfate (CID 88683153) is hexyl(dimethyl)sulfanium;methyl sulfate.
What is the SMILES notation for hexyl(dimethyl)sulfanium;methyl sulfate?
The canonical SMILES for hexyl(dimethyl)sulfanium;methyl sulfate is CCCCCC[S+](C)C.COS(=O)(=O)[O-].
What is the InChIKey of hexyl(dimethyl)sulfanium;methyl sulfate?
The InChIKey is KXDLQKAJJCMXID-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H19S.CH4O4S/c1-4-5-6-7-8-9(2)3;1-5-6(2,3)4/h4-8H2,1-3H3;1H3,(H,2,3,4)/q+1;/p-1.
What are the key properties of hexyl(dimethyl)sulfanium;methyl sulfate?
hexyl(dimethyl)sulfanium;methyl sulfate has a molecular weight of 258.40 g/mol, XLogP of 1.54, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for hexyl(dimethyl)sulfanium;methyl sulfate is sourced from PubChem (CID 88683153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).